Products 1176235-08-7
CAS 1176235-08-7 appears in our catalog under these names: Aka Lumine, AkaLumine, Tokeoni. Offered by: Biosynth, MedChemExpress, Sigma-Aldrich. Available pack sizes: 50mg, 100mg, Get quote, 200MG, 25MG, 5MG.
(4S)-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 1176235-08-7) is a chemical compound with the molecular formula C16H18N2O2S and a molecular weight of 302.4 g/mol. IUPAC name: (4S)-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid. InChIKey: ULTVSKXCSMDCHR-SBRPLTKKSA-N.
| Molecular formula | C16H18N2O2S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (4S)-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| InChIKey | ULTVSKXCSMDCHR-SBRPLTKKSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C=C/C2=N[C@H](CS2)C(=O)O |
Computed by PubChem (NCBI)