Products 117646-83-0

CAS 117646-83-0 is the registry number for 2-(2-((2-Ethylhexyl)oxy)ethoxy)ethyl acrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[2-(2-ethylhexoxy)ethoxy]ethyl prop-2-enoate (CAS 117646-83-0) is a chemical compound with the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. IUPAC name: 2-[2-(2-ethylhexoxy)ethoxy]ethyl prop-2-enoate. InChIKey: XNMJQRPYVCIXGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H28O4
Molecular weight272.38 g/mol
IUPAC name2-[2-(2-ethylhexoxy)ethoxy]ethyl prop-2-enoate
InChIKeyXNMJQRPYVCIXGZ-UHFFFAOYSA-N
SMILESCCCCC(CC)COCCOCCOC(=O)C=C

Computed by PubChem (NCBI)