Products 81749-14-6

CAS 81749-14-6 appears in our catalog under these names: Diisobutylmalonic acid diethyl ester, 98%, Diethyl Diisobutylmalonate, Diethyl Diisobutylmalonate, >98.0%(GC), Diisobutylmalonic acid diethyl ester, 95%, 95%, Diisobutylmalonic acid diethyl ester. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 1ml, 5ml, 25ml, 10g.

Structural formula: {0} (CAS {1})

Diethyl 2,2-bis(2-methylpropyl)propanedioate (CAS 81749-14-6) is a chemical compound with the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. IUPAC name: diethyl 2,2-bis(2-methylpropyl)propanedioate. InChIKey: NIXFNZVGGMZGPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H28O4
Molecular weight272.38 g/mol
IUPAC namediethyl 2,2-bis(2-methylpropyl)propanedioate
InChIKeyNIXFNZVGGMZGPZ-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC(C)C)(CC(C)C)C(=O)OCC

Computed by PubChem (NCBI)