Products 1789702-17-5
CAS 1789702-17-5 appears in our catalog under these names: 11-(Tert-Butoxy)-11-Oxoundecanoic Acid, 97%, 97%, Boc-C9-COOH, 98.0%, 11-(tert-Butoxy)-11-oxoundecanoic acid, 97%, 11-(tert-Butoxy)-11-oxoundecanoic acid, 98%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 100g, 500 mg, 250 mg, 5 g.
11-[(2-methylpropan-2-yl)oxy]-11-oxoundecanoic acid (CAS 1789702-17-5) is a chemical compound with the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. IUPAC name: 11-[(2-methylpropan-2-yl)oxy]-11-oxoundecanoic acid. InChIKey: YRFCVNPOJBZVAQ-UHFFFAOYSA-N.
| Molecular formula | C15H28O4 |
|---|---|
| Molecular weight | 272.38 g/mol |
| IUPAC name | 11-[(2-methylpropan-2-yl)oxy]-11-oxoundecanoic acid |
| InChIKey | YRFCVNPOJBZVAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCCC(=O)O |
Computed by PubChem (NCBI)