Products 1176514-11-6
CAS 1176514-11-6 is the registry number for 7-Hydroxy coumarin b-D-glucuronide methyl ester. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg.
Methyl (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate (CAS 1176514-11-6) is a chemical compound with the molecular formula C16H16O9 and a molecular weight of 352.29 g/mol. IUPAC name: methyl (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate. InChIKey: NLCKRAQRRCQKMC-SSZWKKLZSA-N.
| Molecular formula | C16H16O9 |
|---|---|
| Molecular weight | 352.29 g/mol |
| IUPAC name | methyl (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate |
| InChIKey | NLCKRAQRRCQKMC-SSZWKKLZSA-N |
| SMILES | COC(=O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)OC2=CC3=C(C=C2)C=CC(=O)O3)O)O)O |
Computed by PubChem (NCBI)