Products 24321-18-4
CAS 24321-18-4 is the registry number for Cyclohexanecarboxylicacid. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-[(E)-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid (CAS 24321-18-4) is a chemical compound with the molecular formula C16H16O9 and a molecular weight of 352.29 g/mol. IUPAC name: 3-[(E)-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid. InChIKey: ITENTBHADJNDDH-DUXPYHPUSA-N.
| Molecular formula | C16H16O9 |
|---|---|
| Molecular weight | 352.29 g/mol |
| IUPAC name | 3-[(E)-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| InChIKey | ITENTBHADJNDDH-DUXPYHPUSA-N |
| SMILES | C1C(C(C(CC1(C(=O)O)O)OC(=O)/C=C/C2=CC(=O)C(=O)C=C2)O)O |
Computed by PubChem (NCBI)