CAS 66966-09-4 appears in our catalog under these names: 4-Methylumbelliferyl alfa-L-Iduronide, 4-Methylumbelliferyl α-L-iduronide, 97%, 4-Methylumbelliferyl α-L-iduronide, 99.0%, 4-Methylumbelliferyl-α-L-Iduronide (free acid), 4–Methylumbelliferyl–α–L–Iduronide (free acid). Offered by: Chemat Brand, MedChemExpress, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 500 μg, 1 mg, 1mg, 5mg, 500ug, 500μg, 2mg.
(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid (CAS 66966-09-4) is a chemical compound with the molecular formula C16H16O9 and a molecular weight of 352.29 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid. InChIKey: ARQXEQLMMNGFDU-ZHMBSYLPSA-N.
| Molecular formula | C16H16O9 |
|---|---|
| Molecular weight | 352.29 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid |
| InChIKey | ARQXEQLMMNGFDU-ZHMBSYLPSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)