CAS 117657-41-7 is the registry number for 5-Bromo-1-(tert-butoxycarbonyl)-1H-pyrrole-2-carboxylic acid. Offered by: TRC. Available pack sizes: 500mg.
5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrole-2-carboxylic acid (CAS 117657-41-7) is a chemical compound with the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. IUPAC name: 5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrole-2-carboxylic acid. InChIKey: HSYPLGOVUSKXRC-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4 |
|---|---|
| Molecular weight | 290.11 g/mol |
| IUPAC name | 5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrole-2-carboxylic acid |
| InChIKey | HSYPLGOVUSKXRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=CC=C1Br)C(=O)O |
Computed by PubChem (NCBI)