Products 846059-10-7
CAS 846059-10-7 appears in our catalog under these names: 6-(3-Bromo-2,5-Dioxo-2,5-Dihydro-1H-Pyrrol-1-Yl)Hexanoic Acid, 95%, 95%, 6-(3-Bromo-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)hexanoic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
6-(3-bromo-2,5-dioxopyrrol-1-yl)hexanoic acid (CAS 846059-10-7) is a chemical compound with the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. IUPAC name: 6-(3-bromo-2,5-dioxopyrrol-1-yl)hexanoic acid. InChIKey: CANGISOPPHVYIT-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4 |
|---|---|
| Molecular weight | 290.11 g/mol |
| IUPAC name | 6-(3-bromo-2,5-dioxopyrrol-1-yl)hexanoic acid |
| InChIKey | CANGISOPPHVYIT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)N(C1=O)CCCCCC(=O)O)Br |
Computed by PubChem (NCBI)