CAS 2636670-69-2 is the registry number for Methyl 5-bromo-4,6-dimethoxy-2-methylnicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-bromo-4,6-dimethoxy-2-methylpyridine-3-carboxylate (CAS 2636670-69-2) is a chemical compound with the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. IUPAC name: methyl 5-bromo-4,6-dimethoxy-2-methylpyridine-3-carboxylate. InChIKey: QCKLJFVXEQVRII-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4 |
|---|---|
| Molecular weight | 290.11 g/mol |
| IUPAC name | methyl 5-bromo-4,6-dimethoxy-2-methylpyridine-3-carboxylate |
| InChIKey | QCKLJFVXEQVRII-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)OC)Br)OC)C(=O)OC |
Computed by PubChem (NCBI)