Products 1176775-00-0

CAS 1176775-00-0 appears in our catalog under these names: 3,4-Dimethylcinnoline-6-carboxylic acid, 95%, 3,4-Dimethylcinnoline-6-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

3,4-dimethylcinnoline-6-carboxylic acid (CAS 1176775-00-0) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3,4-dimethylcinnoline-6-carboxylic acid. InChIKey: NZLXMIDRIKRNOV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O2
Molecular weight202.21 g/mol
IUPAC name3,4-dimethylcinnoline-6-carboxylic acid
InChIKeyNZLXMIDRIKRNOV-UHFFFAOYSA-N
SMILESCC1=C(N=NC2=C1C=C(C=C2)C(=O)O)C

Computed by PubChem (NCBI)