CAS 1176775-00-0 appears in our catalog under these names: 3,4-Dimethylcinnoline-6-carboxylic acid, 95%, 3,4-Dimethylcinnoline-6-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3,4-dimethylcinnoline-6-carboxylic acid (CAS 1176775-00-0) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3,4-dimethylcinnoline-6-carboxylic acid. InChIKey: NZLXMIDRIKRNOV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3,4-dimethylcinnoline-6-carboxylic acid |
| InChIKey | NZLXMIDRIKRNOV-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NC2=C1C=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)