Products 117722-36-8
CAS 117722-36-8 is the registry number for (Z)-Ethyl 2-(2-formamidothiazol-4-yl)-2-(methoxyimino)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate (CAS 117722-36-8) is a chemical compound with the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. IUPAC name: ethyl (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate. InChIKey: CSAITDDAMOOJCF-GHXNOFRVSA-N.
| Molecular formula | C9H11N3O4S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | ethyl (2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
| InChIKey | CSAITDDAMOOJCF-GHXNOFRVSA-N |
| SMILES | CCOC(=O)/C(=N\OC)/C1=CSC(=N1)NC=O |
Computed by PubChem (NCBI)