CAS 874640-48-9 is the registry number for 3-((3-Nitropyridin-2-yl)amino)tetrahydrothiophene 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothiolan-3-yl)-3-nitropyridin-2-amine (CAS 874640-48-9) is a chemical compound with the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-3-nitropyridin-2-amine. InChIKey: SEFIHJUTWNUZAH-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O4S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)-3-nitropyridin-2-amine |
| InChIKey | SEFIHJUTWNUZAH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NC2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)