CAS 2073047-06-8 appears in our catalog under these names: 1-Ethyl-7-(methylsulfonyl)-1,4-dihydro-2H-pyrimido[4,5-d][1,3]oxazin-2-one, 95%, 95%, 1-Ethyl-7-(methylsulfonyl)-1,4-dihydro-2H-pyrimido[4,5-d][1,3]oxazin-2-one, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-ethyl-7-methylsulfonyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one (CAS 2073047-06-8) is a chemical compound with the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. IUPAC name: 1-ethyl-7-methylsulfonyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one. InChIKey: LHICKKNIWJSFEB-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O4S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 1-ethyl-7-methylsulfonyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
| InChIKey | LHICKKNIWJSFEB-UHFFFAOYSA-N |
| SMILES | CCN1C2=NC(=NC=C2COC1=O)S(=O)(=O)C |
Computed by PubChem (NCBI)