CAS 117724-63-7 appears in our catalog under these names: 2-Methyl-4-(trifluoromethyl)thiazole-5-carboxylic Acid, >95% (HPLC), 2-Methyl-4-(trifluoromethyl)thiazole-5-carboxylic Acid, >98.0%(GC)(T), 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid, 97% , 2-Methyl-4-(trifluoromethyl)thiazole-5-carboxylic acid 95%, 2-Methyl-4-(trifluoromethyl)thiazole-5-carboxylic Acid, 95%, 95%. Offered by: TRC, TCI, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 1g, 5g, 250MG, 25g, 100g.
2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 117724-63-7) is a chemical compound with the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. IUPAC name: 2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: REKJPVUFKQYMHW-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2S |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | 2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | REKJPVUFKQYMHW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)