CAS 1698908-74-5 is the registry number for Methyl 5-(trifluoromethyl)thiazole-4-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-(trifluoromethyl)-1,3-thiazole-4-carboxylate (CAS 1698908-74-5) is a chemical compound with the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. IUPAC name: methyl 5-(trifluoromethyl)-1,3-thiazole-4-carboxylate. InChIKey: NZOXFSCKIGHJIG-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2S |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | methyl 5-(trifluoromethyl)-1,3-thiazole-4-carboxylate |
| InChIKey | NZOXFSCKIGHJIG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC=N1)C(F)(F)F |
Computed by PubChem (NCBI)