Products 1177273-47-0
CAS 1177273-47-0 is the registry number for 4-(2-Aminoethyl)-5-cyclopropyl-1,2-dihydro-3h-pyrazol-3-one oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-(2-aminoethyl)-5-cyclopropyl-1,2-dihydropyrazol-3-one;oxalic acid (CAS 1177273-47-0) is a chemical compound with the molecular formula C10H15N3O5 and a molecular weight of 257.24 g/mol. IUPAC name: 4-(2-aminoethyl)-5-cyclopropyl-1,2-dihydropyrazol-3-one;oxalic acid. InChIKey: SQUOZYDUQGFTFJ-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O5 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 4-(2-aminoethyl)-5-cyclopropyl-1,2-dihydropyrazol-3-one;oxalic acid |
| InChIKey | SQUOZYDUQGFTFJ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=O)NN2)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)