CAS 927881-61-6 is the registry number for Methyl (1S,3R,4R,5S)-3-acetoxy-5-azido-4-hydroxycyclohexane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1S,3R,4R,5S)-3-acetyloxy-5-azido-4-hydroxycyclohexane-1-carboxylate (CAS 927881-61-6) is a chemical compound with the molecular formula C10H15N3O5 and a molecular weight of 257.24 g/mol. IUPAC name: methyl (1S,3R,4R,5S)-3-acetyloxy-5-azido-4-hydroxycyclohexane-1-carboxylate. InChIKey: NTHLEGIAQAVGBU-RBXMUDONSA-N.
| Molecular formula | C10H15N3O5 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | methyl (1S,3R,4R,5S)-3-acetyloxy-5-azido-4-hydroxycyclohexane-1-carboxylate |
| InChIKey | NTHLEGIAQAVGBU-RBXMUDONSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@H](C[C@@H]([C@H]1O)N=[N+]=[N-])C(=O)OC |
Computed by PubChem (NCBI)