CAS 1177284-74-0 is the registry number for 3-(4-Bromo-3,5-dimethyl-1h-pyrazol-1-yl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanamide (CAS 1177284-74-0) is a chemical compound with the molecular formula C8H12BrN3O and a molecular weight of 246.10 g/mol. IUPAC name: 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanamide. InChIKey: UYFIVANAHNITRK-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3O |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanamide |
| InChIKey | UYFIVANAHNITRK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCC(=O)N)C)Br |
Computed by PubChem (NCBI)