CAS 1282517-46-7 is the registry number for 2-bromo-1-(1-isopropyl-3-methyl-1H-1,2,4-triazol-5-yl)ethanone. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-1-(5-methyl-2-propan-2-yl-1,2,4-triazol-3-yl)ethanone (CAS 1282517-46-7) is a chemical compound with the molecular formula C8H12BrN3O and a molecular weight of 246.10 g/mol. IUPAC name: 2-bromo-1-(5-methyl-2-propan-2-yl-1,2,4-triazol-3-yl)ethanone. InChIKey: FXPJVOPFIMFLSV-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3O |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 2-bromo-1-(5-methyl-2-propan-2-yl-1,2,4-triazol-3-yl)ethanone |
| InChIKey | FXPJVOPFIMFLSV-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)C(=O)CBr)C(C)C |
Computed by PubChem (NCBI)