Products 1272127-66-8
CAS 1272127-66-8 is the registry number for 1-((5-Bromopyrimidin-2-yl)(methyl)amino)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(5-bromopyrimidin-2-yl)-methylamino]propan-2-ol (CAS 1272127-66-8) is a chemical compound with the molecular formula C8H12BrN3O and a molecular weight of 246.10 g/mol. IUPAC name: 1-[(5-bromopyrimidin-2-yl)-methylamino]propan-2-ol. InChIKey: XMSPYZIPDQGZPT-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3O |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 1-[(5-bromopyrimidin-2-yl)-methylamino]propan-2-ol |
| InChIKey | XMSPYZIPDQGZPT-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C1=NC=C(C=N1)Br)O |
Computed by PubChem (NCBI)