CAS 1177318-36-3 is the registry number for 5-((2-Chlorophenoxy)methyl)-4-methyl-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(2-chloro-5-nitrophenyl)-N-methylmethanamine;hydrochloride (CAS 1177318-36-3) is a chemical compound with the molecular formula C8H10Cl2N2O2 and a molecular weight of 237.08 g/mol. IUPAC name: 1-(2-chloro-5-nitrophenyl)-N-methylmethanamine;hydrochloride. InChIKey: FNYIDMOGGOATRB-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2O2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 1-(2-chloro-5-nitrophenyl)-N-methylmethanamine;hydrochloride |
| InChIKey | FNYIDMOGGOATRB-UHFFFAOYSA-N |
| SMILES | CNCC1=C(C=CC(=C1)[N+](=O)[O-])Cl.Cl |
Computed by PubChem (NCBI)