CAS 123578-22-3 is the registry number for 2-Chloro-N-(6-methoxypyridin-3-yl)acetamide hydrochloride 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
2-chloro-N-(6-methoxy-3-pyridinyl)acetamide;hydrochloride (CAS 123578-22-3) is a chemical compound with the molecular formula C8H10Cl2N2O2 and a molecular weight of 237.08 g/mol. IUPAC name: 2-chloro-N-(6-methoxy-3-pyridinyl)acetamide;hydrochloride. InChIKey: BBRWMWICGKDIML-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2O2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 2-chloro-N-(6-methoxy-3-pyridinyl)acetamide;hydrochloride |
| InChIKey | BBRWMWICGKDIML-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)NC(=O)CCl.Cl |
Computed by PubChem (NCBI)