CAS 27123-11-1 is the registry number for 1-((Chloromethoxy)methyl)-2-((hydroxyimino)methyl)-pyridinium Chloride. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
N-[[1-(chloromethoxymethyl)pyridin-1-ium-2-yl]methylidene]hydroxylamine chloride (CAS 27123-11-1) is a chemical compound with the molecular formula C8H10Cl2N2O2 and a molecular weight of 237.08 g/mol. IUPAC name: N-[[1-(chloromethoxymethyl)pyridin-1-ium-2-yl]methylidene]hydroxylamine chloride. InChIKey: DZKHTMVXEHCDMQ-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2O2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | N-[[1-(chloromethoxymethyl)pyridin-1-ium-2-yl]methylidene]hydroxylamine chloride |
| InChIKey | DZKHTMVXEHCDMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=[N+](C(=C1)C=NO)COCCl.[Cl-] |
Computed by PubChem (NCBI)