CAS 1177320-67-0 appears in our catalog under these names: 2-Chloro-4,7-difluorobenzo[d]thiazole, 95%, 2–Chloro–4,7–difluorobenzo(d)thiazole, 2-Chloro-4,7-difluorobenzo[d]thiazole 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
2-chloro-4,7-difluoro-1,3-benzothiazole (CAS 1177320-67-0) is a chemical compound with the molecular formula C7H2ClF2NS and a molecular weight of 205.61 g/mol. IUPAC name: 2-chloro-4,7-difluoro-1,3-benzothiazole. InChIKey: YFFVYUGQFUQXNZ-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF2NS |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | 2-chloro-4,7-difluoro-1,3-benzothiazole |
| InChIKey | YFFVYUGQFUQXNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)N=C(S2)Cl)F |
Computed by PubChem (NCBI)