CAS 1713163-05-3 is the registry number for 3-Chloro-2,4-difluorophenylisothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1,3-difluoro-4-isothiocyanatobenzene (CAS 1713163-05-3) is a chemical compound with the molecular formula C7H2ClF2NS and a molecular weight of 205.61 g/mol. IUPAC name: 2-chloro-1,3-difluoro-4-isothiocyanatobenzene. InChIKey: KUANXYWNTJSWCD-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF2NS |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | 2-chloro-1,3-difluoro-4-isothiocyanatobenzene |
| InChIKey | KUANXYWNTJSWCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N=C=S)F)Cl)F |
Computed by PubChem (NCBI)