Products 1895912-44-3
CAS 1895912-44-3 is the registry number for 1-Chloro-2,3-difluoro-4-isothiocyanatobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2,3-difluoro-4-isothiocyanatobenzene (CAS 1895912-44-3) is a chemical compound with the molecular formula C7H2ClF2NS and a molecular weight of 205.61 g/mol. IUPAC name: 1-chloro-2,3-difluoro-4-isothiocyanatobenzene. InChIKey: NYFRSBXRRABDDY-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF2NS |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | 1-chloro-2,3-difluoro-4-isothiocyanatobenzene |
| InChIKey | NYFRSBXRRABDDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N=C=S)F)F)Cl |
Computed by PubChem (NCBI)