CAS 1177342-40-3 appears in our catalog under these names: 4-Amino-1-(2-chlorophenyl)pyrrolidin-2-one hydrochloride, 95%, 4-Amino-1-(2-chlorophenyl)-2-pyrrolidinone hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
4-amino-1-(2-chlorophenyl)pyrrolidin-2-one;hydrochloride (CAS 1177342-40-3) is a chemical compound with the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. IUPAC name: 4-amino-1-(2-chlorophenyl)pyrrolidin-2-one;hydrochloride. InChIKey: SHRBSECGJGFXFF-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | 4-amino-1-(2-chlorophenyl)pyrrolidin-2-one;hydrochloride |
| InChIKey | SHRBSECGJGFXFF-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=CC=C2Cl)N.Cl |
Computed by PubChem (NCBI)