CAS 1334612-24-6 appears in our catalog under these names: N-(tert-Butyl)-2,6-dichloronicotinamide, 95%, N-(tert-Butyl)-2,6-dichloronicotinamide, 97%, N-(tert-butyl)-2,6-dichloronicotinamide, ≥95%, ≥95%, N-(tert-butyl)-2,6-dichloronicotinamide. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
N-tert-butyl-2,6-dichloropyridine-3-carboxamide (CAS 1334612-24-6) is a chemical compound with the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. IUPAC name: N-tert-butyl-2,6-dichloropyridine-3-carboxamide. InChIKey: HAOQVMZSAHIIRY-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | N-tert-butyl-2,6-dichloropyridine-3-carboxamide |
| InChIKey | HAOQVMZSAHIIRY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)