Products 1266226-29-2
CAS 1266226-29-2 appears in our catalog under these names: 3-Amino-8-methoxyquinoline dihydrochloride, 95%, 8-Methoxyquinolin-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
8-methoxyquinolin-3-amine;dihydrochloride (CAS 1266226-29-2) is a chemical compound with the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. IUPAC name: 8-methoxyquinolin-3-amine;dihydrochloride. InChIKey: VKLPWBXHQFBOTP-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | 8-methoxyquinolin-3-amine;dihydrochloride |
| InChIKey | VKLPWBXHQFBOTP-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=CC(=CN=C21)N.Cl.Cl |
Computed by PubChem (NCBI)