CAS 1177346-98-3 appears in our catalog under these names: Methyl 4-(piperazin-1-ylsulfonyl)benzoate hydrochloride, 95%, Methyl 4-(piperazin-1-ylsulfonyl)benzoate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
Methyl 4-piperazin-1-ylsulfonylbenzoate;hydrochloride (CAS 1177346-98-3) is a chemical compound with the molecular formula C12H17ClN2O4S and a molecular weight of 320.79 g/mol. IUPAC name: methyl 4-piperazin-1-ylsulfonylbenzoate;hydrochloride. InChIKey: MPCCJAMVFHNGHQ-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O4S |
|---|---|
| Molecular weight | 320.79 g/mol |
| IUPAC name | methyl 4-piperazin-1-ylsulfonylbenzoate;hydrochloride |
| InChIKey | MPCCJAMVFHNGHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)S(=O)(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)