Products 862088-87-7
CAS 862088-87-7 appears in our catalog under these names: 3-[(4-Methyl-1-piperazinyl)sulfonyl]benzoic acid hydrochloride, 95%, 3-((4-Methylpiperazin-1-yl)sulfonyl)benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid;hydrochloride (CAS 862088-87-7) is a chemical compound with the molecular formula C12H17ClN2O4S and a molecular weight of 320.79 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid;hydrochloride. InChIKey: SGZGWMYJPUILLY-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O4S |
|---|---|
| Molecular weight | 320.79 g/mol |
| IUPAC name | 3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid;hydrochloride |
| InChIKey | SGZGWMYJPUILLY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)