CAS 1214078-25-7 is the registry number for 1-[(3-Aminophenyl)sulfonyl]piperidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1-(3-aminophenyl)sulfonylpiperidine-2-carboxylic acid;hydrochloride (CAS 1214078-25-7) is a chemical compound with the molecular formula C12H17ClN2O4S and a molecular weight of 320.79 g/mol. IUPAC name: 1-(3-aminophenyl)sulfonylpiperidine-2-carboxylic acid;hydrochloride. InChIKey: FPFWHLIEAMHWKR-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O4S |
|---|---|
| Molecular weight | 320.79 g/mol |
| IUPAC name | 1-(3-aminophenyl)sulfonylpiperidine-2-carboxylic acid;hydrochloride |
| InChIKey | FPFWHLIEAMHWKR-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)S(=O)(=O)C2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)