Products 2519489-73-5
CAS 2519489-73-5 appears in our catalog under these names: Cilastatin Impurity 24, Cilastatin Impurity 17, (Z)-7-Chloro-2-(2,3-dimethylbut-3-enamido)hept-2-enoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(Z)-7-chloro-2-(2,3-dimethylbut-3-enoylamino)hept-2-enoic acid (CAS 2519489-73-5) is a chemical compound with the molecular formula C13H20ClNO3 and a molecular weight of 273.75 g/mol. IUPAC name: (Z)-7-chloro-2-(2,3-dimethylbut-3-enoylamino)hept-2-enoic acid. InChIKey: QKLCMUIEJAPCNQ-XFFZJAGNSA-N.
| Molecular formula | C13H20ClNO3 |
|---|---|
| Molecular weight | 273.75 g/mol |
| IUPAC name | (Z)-7-chloro-2-(2,3-dimethylbut-3-enoylamino)hept-2-enoic acid |
| InChIKey | QKLCMUIEJAPCNQ-XFFZJAGNSA-N |
| SMILES | CC(C(=C)C)C(=O)N/C(=C\CCCCCl)/C(=O)O |
Computed by PubChem (NCBI)