CAS 1956321-87-1 appears in our catalog under these names: Bisoprolol EP Impurity L HCl (Metoprolol EP Impurity C HCl), Metoprolol Impurity 3(Metoprolol EP Impurity C HCl), 4-((2RS)-2-Hydroxy-3-((1-methylethyl)amino)propoxy)benzaldehyde Hydrochloride, 4-((2RS)-2-Hydroxy-3-((1-methylethyl)amino)propoxy)-benzaldehyde hydrochloride, 4-(2-Hydroxy-3-(isopropylamino)propoxy)benzaldehyde hydrochloride, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,25g, 0,1g.
4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzaldehyde;hydrochloride (CAS 1956321-87-1) is a chemical compound with the molecular formula C13H20ClNO3 and a molecular weight of 273.75 g/mol. IUPAC name: 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzaldehyde;hydrochloride. InChIKey: NEQCKPQTNHQOIV-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO3 |
|---|---|
| Molecular weight | 273.75 g/mol |
| IUPAC name | 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzaldehyde;hydrochloride |
| InChIKey | NEQCKPQTNHQOIV-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)C=O)O.Cl |
Computed by PubChem (NCBI)