CAS 1177419-85-0 appears in our catalog under these names: Dextromethorphan Impurity 5, Dextromethorphan N-Oxide Hydrochloride. Offered by: Hubei YoungXin, Mikromol, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg, 5mg.
4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride (CAS 1177419-85-0) is a chemical compound with the molecular formula C18H26ClNO2 and a molecular weight of 323.9 g/mol. IUPAC name: 4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride. InChIKey: JJXFRVFGFPYDCZ-UHFFFAOYSA-N.
| Molecular formula | C18H26ClNO2 |
|---|---|
| Molecular weight | 323.9 g/mol |
| IUPAC name | 4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene;hydrochloride |
| InChIKey | JJXFRVFGFPYDCZ-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCC23CCCCC2C1CC4=C3C=C(C=C4)OC)[O-].Cl |
Computed by PubChem (NCBI)