CAS 2437328-06-6 is the registry number for Ethyl (2S,3R)-3-allyl-1-((S)-1-phenylethyl)pyrrolidine-2-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S,3R)-1-[(1S)-1-phenylethyl]-3-prop-2-enylpyrrolidine-2-carboxylate;hydrochloride (CAS 2437328-06-6) is a chemical compound with the molecular formula C18H26ClNO2 and a molecular weight of 323.9 g/mol. IUPAC name: ethyl (2S,3R)-1-[(1S)-1-phenylethyl]-3-prop-2-enylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: IYYFULAYQVITMI-XAUMKULISA-N.
| Molecular formula | C18H26ClNO2 |
|---|---|
| Molecular weight | 323.9 g/mol |
| IUPAC name | ethyl (2S,3R)-1-[(1S)-1-phenylethyl]-3-prop-2-enylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | IYYFULAYQVITMI-XAUMKULISA-N |
| SMILES | CCOC(=O)[C@@H]1[C@@H](CCN1[C@@H](C)C2=CC=CC=C2)CC=C.Cl |
Computed by PubChem (NCBI)