Products 474382-57-5
CAS 474382-57-5 is the registry number for (4S)-4-Cyclohexyl-L-proline Phenylmethyl Ester Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
Benzyl (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylate;hydrochloride (CAS 474382-57-5) is a chemical compound with the molecular formula C18H26ClNO2 and a molecular weight of 323.9 g/mol. IUPAC name: benzyl (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: HMJNITCOAYGNQQ-PPPUBMIESA-N.
| Molecular formula | C18H26ClNO2 |
|---|---|
| Molecular weight | 323.9 g/mol |
| IUPAC name | benzyl (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | HMJNITCOAYGNQQ-PPPUBMIESA-N |
| SMILES | C1CCC(CC1)[C@@H]2C[C@H](NC2)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)