CAS 1177924-37-6 is the registry number for (3-(1,3-Dihydro-2H-isoindol-2-yl)propyl)amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-isoindol-2-ylpropan-1-amine;dihydrochloride (CAS 1177924-37-6) is a chemical compound with the molecular formula C11H16Cl2N2 and a molecular weight of 247.16 g/mol. IUPAC name: 3-isoindol-2-ylpropan-1-amine;dihydrochloride. InChIKey: SYTHCUSTCXFJLE-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2 |
|---|---|
| Molecular weight | 247.16 g/mol |
| IUPAC name | 3-isoindol-2-ylpropan-1-amine;dihydrochloride |
| InChIKey | SYTHCUSTCXFJLE-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN(C=C2C=C1)CCCN.Cl.Cl |
Computed by PubChem (NCBI)