CAS 435342-11-3 is the registry number for 1-(4-Chloro-benzyl)-piperazinehydrochloride. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g.
1-[(4-chlorophenyl)methyl]piperazine;hydrochloride (CAS 435342-11-3) is a chemical compound with the molecular formula C11H16Cl2N2 and a molecular weight of 247.16 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]piperazine;hydrochloride. InChIKey: ZKQKYKNSUWSKAN-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2 |
|---|---|
| Molecular weight | 247.16 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]piperazine;hydrochloride |
| InChIKey | ZKQKYKNSUWSKAN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)