CAS 1638968-12-3 is the registry number for 6-Methyl-1',2',3',6'-tetrahydro-2,4'-bipyridine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)pyridine;dihydrochloride (CAS 1638968-12-3) is a chemical compound with the molecular formula C11H16Cl2N2 and a molecular weight of 247.16 g/mol. IUPAC name: 2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)pyridine;dihydrochloride. InChIKey: ORJLXUGYLZTHDH-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2 |
|---|---|
| Molecular weight | 247.16 g/mol |
| IUPAC name | 2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)pyridine;dihydrochloride |
| InChIKey | ORJLXUGYLZTHDH-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)