CAS 1178104-53-4 is the registry number for 4'-(2-methylpropyl)-[1,1'-Biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(2-methylpropyl)phenyl]aniline (CAS 1178104-53-4) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: 4-[4-(2-methylpropyl)phenyl]aniline. InChIKey: VMGPHQMQFBIYDE-UHFFFAOYSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | 4-[4-(2-methylpropyl)phenyl]aniline |
| InChIKey | VMGPHQMQFBIYDE-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)