CAS 117811-18-4 appears in our catalog under these names: Loratadine Impurity 32, Desloratadine Impurity 13, 5,6-Dehydro-N-methyl Desloratadine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
13-chloro-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (CAS 117811-18-4) is a chemical compound with the molecular formula C20H19ClN2 and a molecular weight of 322.8 g/mol. IUPAC name: 13-chloro-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene. InChIKey: UQPDCFDFUFTVEA-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN2 |
|---|---|
| Molecular weight | 322.8 g/mol |
| IUPAC name | 13-chloro-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| InChIKey | UQPDCFDFUFTVEA-UHFFFAOYSA-N |
| SMILES | CN1CCC(=C2C3=C(C=CC4=C2N=CC=C4)C=C(C=C3)Cl)CC1 |
Computed by PubChem (NCBI)