Products 6484-78-2
CAS 6484-78-2 is the registry number for Sempervirine methochloride. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methyl-16,17,18,19-tetrahydroyohimban-13-ium chloride (CAS 6484-78-2) is a chemical compound with the molecular formula C20H19ClN2 and a molecular weight of 322.8 g/mol. IUPAC name: 3-methyl-16,17,18,19-tetrahydroyohimban-13-ium chloride. InChIKey: HIROAYNAUQCTHO-UHFFFAOYSA-M.
| Molecular formula | C20H19ClN2 |
|---|---|
| Molecular weight | 322.8 g/mol |
| IUPAC name | 3-methyl-16,17,18,19-tetrahydroyohimban-13-ium chloride |
| InChIKey | HIROAYNAUQCTHO-UHFFFAOYSA-M |
| SMILES | CN1C2=CC=CC=C2C3=C1C4=[N+](C=C3)C=C5CCCCC5=C4.[Cl-] |
Computed by PubChem (NCBI)