Products 1443732-36-2
CAS 1443732-36-2 is the registry number for 5-Chloro-2,3-bis(3,5-dimethylphenyl)pyrazine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2,3-bis(3,5-dimethylphenyl)pyrazine (CAS 1443732-36-2) is a chemical compound with the molecular formula C20H19ClN2 and a molecular weight of 322.8 g/mol. IUPAC name: 5-chloro-2,3-bis(3,5-dimethylphenyl)pyrazine. InChIKey: SJVAJWMXEPSSHP-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN2 |
|---|---|
| Molecular weight | 322.8 g/mol |
| IUPAC name | 5-chloro-2,3-bis(3,5-dimethylphenyl)pyrazine |
| InChIKey | SJVAJWMXEPSSHP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=NC=C(N=C2C3=CC(=CC(=C3)C)C)Cl)C |
Computed by PubChem (NCBI)