Products 1178372-80-9
CAS 1178372-80-9 is the registry number for 3-Amino-4-(2,2-difluoroethoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-amino-4-(2,2-difluoroethoxy)benzoic acid (CAS 1178372-80-9) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: 3-amino-4-(2,2-difluoroethoxy)benzoic acid. InChIKey: OUZDZKUMDKRODS-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO3 |
|---|---|
| Molecular weight | 217.17 g/mol |
| IUPAC name | 3-amino-4-(2,2-difluoroethoxy)benzoic acid |
| InChIKey | OUZDZKUMDKRODS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)OCC(F)F |
Computed by PubChem (NCBI)