CAS 117872-75-0 appears in our catalog under these names: Fmoc–Thr(Bzl)–OH, Fmoc-L-Thr(Bzl)-OH, Fmoc-Thr(Bzl)-OH 95%, Fmoc-Thr(Bzl)-OH, 98%, 98%, Fmoc-Thr(Bzl)-OH, 97%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 250g, 10g, 500g, 1g.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxybutanoic acid (CAS 117872-75-0) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxybutanoic acid. InChIKey: UCDMMWCWPVCHLL-OSPHWJPCSA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxybutanoic acid |
| InChIKey | UCDMMWCWPVCHLL-OSPHWJPCSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)