CAS 131545-63-6 appears in our catalog under these names: Fmoc–D–Thr(Bzl)–OH, Fmoc-D-Thr(Bzl)-OH, Fmoc-D-Thr(Bzl)-OH 95%, (2R,3S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(benzyloxy)butanoic acid, 98%, 98%, Fmoc-D-Thr(Bzl)-OH, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxybutanoic acid (CAS 131545-63-6) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxybutanoic acid. InChIKey: UCDMMWCWPVCHLL-BXKMTCNYSA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxybutanoic acid |
| InChIKey | UCDMMWCWPVCHLL-BXKMTCNYSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)