CAS 1178722-67-2 appears in our catalog under these names: 2,3-Dimethyl-6-(4-methylphenoxy)-1,4-dihydroquinolin-4-one, 95%, 2,3-Dimethyl-6-(4-methylphenoxy)-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2,3-dimethyl-6-(4-methylphenoxy)-1H-quinolin-4-one (CAS 1178722-67-2) is a chemical compound with the molecular formula C18H17NO2 and a molecular weight of 279.3 g/mol. IUPAC name: 2,3-dimethyl-6-(4-methylphenoxy)-1H-quinolin-4-one. InChIKey: OGYASEAEQPHEEA-UHFFFAOYSA-N.
| Molecular formula | C18H17NO2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 2,3-dimethyl-6-(4-methylphenoxy)-1H-quinolin-4-one |
| InChIKey | OGYASEAEQPHEEA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC3=C(C=C2)NC(=C(C3=O)C)C |
Computed by PubChem (NCBI)