Products 1178758-86-5
CAS 1178758-86-5 is the registry number for 6-Amino-5-(isopropylamino)-1-methylpyrimidine-2,4(1H,3H)-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-1-methyl-5-(propan-2-ylamino)pyrimidine-2,4-dione (CAS 1178758-86-5) is a chemical compound with the molecular formula C8H14N4O2 and a molecular weight of 198.22 g/mol. IUPAC name: 6-amino-1-methyl-5-(propan-2-ylamino)pyrimidine-2,4-dione. InChIKey: YHPULGQFOVDBHH-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 6-amino-1-methyl-5-(propan-2-ylamino)pyrimidine-2,4-dione |
| InChIKey | YHPULGQFOVDBHH-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(N(C(=O)NC1=O)C)N |
Computed by PubChem (NCBI)